Toluidine red is an organic compound with the formula C10H6(OH)(N2C6H3(NO2)CH3). A dark red solid, the compound is classified as a azo dye consisting of a 2-naphthol group linked to a 2-nitro-4-methylphenyl substituent.
The compounds of every Wikipedia article carrying a Chembox or a Drugbox, refreshed daily, with the values their infoboxes give. The pages need JavaScript; the API does not.